CAS 1794905-25-1 appears in our catalog under these names: Acetanthranil-d3, Acetanthranil–d3. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 50mg, 25 mg, 2.5 mg.
2-(trideuteriomethyl)-3,1-benzoxazin-4-one (CAS 1794905-25-1) is a chemical compound with the molecular formula C9H7NO2 and a molecular weight of 164.18 g/mol. IUPAC name: 2-(trideuteriomethyl)-3,1-benzoxazin-4-one. InChIKey: WMQSKECCMQRJRX-FIBGUPNXSA-N.
| Molecular formula | C9H7NO2 |
|---|---|
| Molecular weight | 164.18 g/mol |
| IUPAC name | 2-(trideuteriomethyl)-3,1-benzoxazin-4-one |
| InChIKey | WMQSKECCMQRJRX-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=NC2=CC=CC=C2C(=O)O1 |
Computed by PubChem (NCBI)