Products 1794938-50-3
CAS 1794938-50-3 appears in our catalog under these names: a-Aminoacetophenone-d5 Hydrochloride, >95% (HPLC), Alpha-Aminoacetophenone-d5 Hydrochloride, >95% (HPLC), 2-Aminoacetophenone-d5 (hydrochloride). Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 10mg, 50mg, 10 mg, 100 mg, 50 mg.
2-amino-1-(2,3,4,5,6-pentadeuteriophenyl)ethanone;hydrochloride (CAS 1794938-50-3) is a chemical compound with the molecular formula C8H10ClNO and a molecular weight of 176.65 g/mol. IUPAC name: 2-amino-1-(2,3,4,5,6-pentadeuteriophenyl)ethanone;hydrochloride. InChIKey: CVXGFPPAIUELDV-GWVWGMRQSA-N.
| Molecular formula | C8H10ClNO |
|---|---|
| Molecular weight | 176.65 g/mol |
| IUPAC name | 2-amino-1-(2,3,4,5,6-pentadeuteriophenyl)ethanone;hydrochloride |
| InChIKey | CVXGFPPAIUELDV-GWVWGMRQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(=O)CN)[2H])[2H].Cl |
Computed by PubChem (NCBI)