CAS 1794970-97-0 appears in our catalog under these names: rac Mepindolol-d7, >95% (HPLC), (rac)-Mepindolol-d7. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg.
1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-3-[(2-methyl-1H-indol-4-yl)oxy]propan-2-ol (CAS 1794970-97-0) is a chemical compound with the molecular formula C15H22N2O2 and a molecular weight of 269.39 g/mol. IUPAC name: 1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-3-[(2-methyl-1H-indol-4-yl)oxy]propan-2-ol. InChIKey: NXWGWUVGUSFQJC-SVMCCORHSA-N.
| Molecular formula | C15H22N2O2 |
|---|---|
| Molecular weight | 269.39 g/mol |
| IUPAC name | 1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-3-[(2-methyl-1H-indol-4-yl)oxy]propan-2-ol |
| InChIKey | NXWGWUVGUSFQJC-SVMCCORHSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])NCC(COC1=CC=CC2=C1C=C(N2)C)O |
Computed by PubChem (NCBI)