CAS 1795014-50-4 is the registry number for Methoxetamine-d5. Offered by: TRC. Available pack sizes: 25mg.
2-(3-methoxyphenyl)-2-(1,1,2,2,2-pentadeuterioethylamino)cyclohexan-1-one (CAS 1795014-50-4) is a chemical compound with the molecular formula C15H21NO2 and a molecular weight of 252.36 g/mol. IUPAC name: 2-(3-methoxyphenyl)-2-(1,1,2,2,2-pentadeuterioethylamino)cyclohexan-1-one. InChIKey: LPKTWLVEGBNOOX-WNWXXORZSA-N.
| Molecular formula | C15H21NO2 |
|---|---|
| Molecular weight | 252.36 g/mol |
| IUPAC name | 2-(3-methoxyphenyl)-2-(1,1,2,2,2-pentadeuterioethylamino)cyclohexan-1-one |
| InChIKey | LPKTWLVEGBNOOX-WNWXXORZSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])NC1(CCCCC1=O)C2=CC(=CC=C2)OC |
Computed by PubChem (NCBI)