CAS 1795020-86-8 is the registry number for Xylazine-d6 Hydrochloride, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 1mg.
N-[2,6-bis(trideuteriomethyl)phenyl]-5,6-dihydro-4H-1,3-thiazin-2-amine;hydrochloride (CAS 1795020-86-8) is a chemical compound with the molecular formula C12H17ClN2S and a molecular weight of 262.83 g/mol. IUPAC name: N-[2,6-bis(trideuteriomethyl)phenyl]-5,6-dihydro-4H-1,3-thiazin-2-amine;hydrochloride. InChIKey: QYEFBJRXKKSABU-TXHXQZCNSA-N.
| Molecular formula | C12H17ClN2S |
|---|---|
| Molecular weight | 262.83 g/mol |
| IUPAC name | N-[2,6-bis(trideuteriomethyl)phenyl]-5,6-dihydro-4H-1,3-thiazin-2-amine;hydrochloride |
| InChIKey | QYEFBJRXKKSABU-TXHXQZCNSA-N |
| SMILES | [2H]C([2H])([2H])C1=C(C(=CC=C1)C([2H])([2H])[2H])NC2=NCCCS2.Cl |
Computed by PubChem (NCBI)