CAS 1795024-97-3 appears in our catalog under these names: Setiptiline-d3, >95% (HPLC), Setiptiline-d3. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
4-(trideuteriomethyl)-4-azatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),2(7),8,10,12,15,17-heptaene (CAS 1795024-97-3) is a chemical compound with the molecular formula C19H19N and a molecular weight of 264.4 g/mol. IUPAC name: 4-(trideuteriomethyl)-4-azatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),2(7),8,10,12,15,17-heptaene. InChIKey: GVPIXRLYKVFFMK-FIBGUPNXSA-N.
| Molecular formula | C19H19N |
|---|---|
| Molecular weight | 264.4 g/mol |
| IUPAC name | 4-(trideuteriomethyl)-4-azatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),2(7),8,10,12,15,17-heptaene |
| InChIKey | GVPIXRLYKVFFMK-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1CCC2=C(C1)C3=CC=CC=C3CC4=CC=CC=C24 |
Computed by PubChem (NCBI)