Products 404913-09-3
CAS 404913-09-3 is the registry number for 5,6,7,8,9,10-Hexahydro-5-phenylcyclohept(b)indole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g.
5-phenyl-7,8,9,10-tetrahydro-6H-cyclohepta[b]indole (CAS 404913-09-3) is a chemical compound with the molecular formula C19H19N and a molecular weight of 261.4 g/mol. IUPAC name: 5-phenyl-7,8,9,10-tetrahydro-6H-cyclohepta[b]indole. InChIKey: ZWYGMNJERQJHTJ-UHFFFAOYSA-N.
| Molecular formula | C19H19N |
|---|---|
| Molecular weight | 261.4 g/mol |
| IUPAC name | 5-phenyl-7,8,9,10-tetrahydro-6H-cyclohepta[b]indole |
| InChIKey | ZWYGMNJERQJHTJ-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(CC1)N(C3=CC=CC=C23)C4=CC=CC=C4 |
Computed by PubChem (NCBI)