Products 1795025-62-5
CAS 1795025-62-5 is the registry number for N-Methyl-2-piperidinemethyl-d5 Chloride. Offered by: TRC. Available pack sizes: 250mg, 25mg.
2-[chloro(dideuterio)methyl]-1-(trideuteriomethyl)piperidine (CAS 1795025-62-5) is a chemical compound with the molecular formula C7H14ClN and a molecular weight of 152.67 g/mol. IUPAC name: 2-[chloro(dideuterio)methyl]-1-(trideuteriomethyl)piperidine. InChIKey: FGMRHGUEOYXVMX-YRYIGFSMSA-N.
| Molecular formula | C7H14ClN |
|---|---|
| Molecular weight | 152.67 g/mol |
| IUPAC name | 2-[chloro(dideuterio)methyl]-1-(trideuteriomethyl)piperidine |
| InChIKey | FGMRHGUEOYXVMX-YRYIGFSMSA-N |
| SMILES | [2H]C([2H])([2H])N1CCCCC1C([2H])([2H])Cl |
Computed by PubChem (NCBI)