CAS 1795142-11-8 is the registry number for (E)-N-Methylcinnamylamine-d3. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 2.5 mg, 25 mg.
(E)-3-phenyl-N-(trideuteriomethyl)prop-2-en-1-amine;hydrochloride (CAS 1795142-11-8) is a chemical compound with the molecular formula C10H14ClN and a molecular weight of 186.69 g/mol. IUPAC name: (E)-3-phenyl-N-(trideuteriomethyl)prop-2-en-1-amine;hydrochloride. InChIKey: XGJZECMFJCEEJU-ZRHZDPIFSA-N.
| Molecular formula | C10H14ClN |
|---|---|
| Molecular weight | 186.69 g/mol |
| IUPAC name | (E)-3-phenyl-N-(trideuteriomethyl)prop-2-en-1-amine;hydrochloride |
| InChIKey | XGJZECMFJCEEJU-ZRHZDPIFSA-N |
| SMILES | [2H]C([2H])([2H])NC/C=C/C1=CC=CC=C1.Cl |
Computed by PubChem (NCBI)