CAS 1795292-03-3 appears in our catalog under these names: 2-Methyl-5-(piperidin-4-yl)-2,3-dihydro-1H-1,2,4-triazol-3-imine dihydrochloride, 95%, 1-Methyl-3-(piperidin-4-yl)-1H-1,2,4-triazol-5-amine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-methyl-5-piperidin-4-yl-1,2,4-triazol-3-amine;dihydrochloride (CAS 1795292-03-3) is a chemical compound with the molecular formula C8H17Cl2N5 and a molecular weight of 254.16 g/mol. IUPAC name: 2-methyl-5-piperidin-4-yl-1,2,4-triazol-3-amine;dihydrochloride. InChIKey: ZVIPUIUHFYFZDT-UHFFFAOYSA-N.
| Molecular formula | C8H17Cl2N5 |
|---|---|
| Molecular weight | 254.16 g/mol |
| IUPAC name | 2-methyl-5-piperidin-4-yl-1,2,4-triazol-3-amine;dihydrochloride |
| InChIKey | ZVIPUIUHFYFZDT-UHFFFAOYSA-N |
| SMILES | CN1C(=NC(=N1)C2CCNCC2)N.Cl.Cl |
Computed by PubChem (NCBI)