CAS 2230807-04-0 is the registry number for 1-Methyl-3-(piperidin-3-yl)-1H-1,2,4-triazol-5-amine dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-methyl-5-piperidin-3-yl-1,2,4-triazol-3-amine;dihydrochloride (CAS 2230807-04-0) is a chemical compound with the molecular formula C8H17Cl2N5 and a molecular weight of 254.16 g/mol. IUPAC name: 2-methyl-5-piperidin-3-yl-1,2,4-triazol-3-amine;dihydrochloride. InChIKey: VFHWXVCIPKQGMU-UHFFFAOYSA-N.
| Molecular formula | C8H17Cl2N5 |
|---|---|
| Molecular weight | 254.16 g/mol |
| IUPAC name | 2-methyl-5-piperidin-3-yl-1,2,4-triazol-3-amine;dihydrochloride |
| InChIKey | VFHWXVCIPKQGMU-UHFFFAOYSA-N |
| SMILES | CN1C(=NC(=N1)C2CCCNC2)N.Cl.Cl |
Computed by PubChem (NCBI)