CAS 1795513-87-9 is the registry number for (4-Chloro-2,5-difluorophenyl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(4-chloro-2,5-difluorophenyl)methanamine;hydrochloride (CAS 1795513-87-9) is a chemical compound with the molecular formula C7H7Cl2F2N and a molecular weight of 214.04 g/mol. IUPAC name: (4-chloro-2,5-difluorophenyl)methanamine;hydrochloride. InChIKey: ADMLZGNJDGYPKG-UHFFFAOYSA-N.
| Molecular formula | C7H7Cl2F2N |
|---|---|
| Molecular weight | 214.04 g/mol |
| IUPAC name | (4-chloro-2,5-difluorophenyl)methanamine;hydrochloride |
| InChIKey | ADMLZGNJDGYPKG-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)Cl)F)CN.Cl |
Computed by PubChem (NCBI)