CAS 1956354-72-5 is the registry number for (4-Chloro-2,6-difluorophenyl)methanamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
(4-chloro-2,6-difluorophenyl)methanamine;hydrochloride (CAS 1956354-72-5) is a chemical compound with the molecular formula C7H7Cl2F2N and a molecular weight of 214.04 g/mol. IUPAC name: (4-chloro-2,6-difluorophenyl)methanamine;hydrochloride. InChIKey: XKXLSSVBUYBMIV-UHFFFAOYSA-N.
| Molecular formula | C7H7Cl2F2N |
|---|---|
| Molecular weight | 214.04 g/mol |
| IUPAC name | (4-chloro-2,6-difluorophenyl)methanamine;hydrochloride |
| InChIKey | XKXLSSVBUYBMIV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)CN)F)Cl.Cl |
Computed by PubChem (NCBI)