CAS 179552-74-0 appears in our catalog under these names: Afatinib Impurity 5, N-(3-Chloro-4-fluorophenyl)-7-methoxy-6-nitroquinazolin-4-amine, N–(3–Chloro–4–fluorophenyl)–7–methoxy–6–nitroquinazolin–4–amine, Dacomitinib Intermediate 2/ 99.27% (existing batch purity), Dacomitinib Intermediate 2 97%. Offered by: Chemat Brand, TRC, GLPBio, TargetMol, Ambeed. Available pack sizes: on request, 5g, 10g, 1g, 250mg, 25g, 5mg, 10mg.
N-(3-chloro-4-fluorophenyl)-7-methoxy-6-nitroquinazolin-4-amine (CAS 179552-74-0) is a chemical compound with the molecular formula C15H10ClFN4O3 and a molecular weight of 348.71 g/mol. IUPAC name: N-(3-chloro-4-fluorophenyl)-7-methoxy-6-nitroquinazolin-4-amine. InChIKey: VKEKKVCWODTGAP-UHFFFAOYSA-N.
| Molecular formula | C15H10ClFN4O3 |
|---|---|
| Molecular weight | 348.71 g/mol |
| IUPAC name | N-(3-chloro-4-fluorophenyl)-7-methoxy-6-nitroquinazolin-4-amine |
| InChIKey | VKEKKVCWODTGAP-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)N=CN=C2NC3=CC(=C(C=C3)F)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)