CAS 2803456-91-7 appears in our catalog under these names: N-(4-Chloro-3-fluorophenyl)-7-methoxy-6-nitroquinazolin-4-amine (Dacomitinib Impurity), 97%, 97%, Dacomitinib impurity 16, 97.0%. Offered by: Chemat, MedChemExpress. Available pack sizes: 50mg, 5 mg, 10 mg, 25 mg, 50 mg.
N-(4-chloro-3-fluorophenyl)-7-methoxy-6-nitroquinazolin-4-amine (CAS 2803456-91-7) is a chemical compound with the molecular formula C15H10ClFN4O3 and a molecular weight of 348.71 g/mol. IUPAC name: N-(4-chloro-3-fluorophenyl)-7-methoxy-6-nitroquinazolin-4-amine. InChIKey: RJOOQLDHTIHUML-UHFFFAOYSA-N.
| Molecular formula | C15H10ClFN4O3 |
|---|---|
| Molecular weight | 348.71 g/mol |
| IUPAC name | N-(4-chloro-3-fluorophenyl)-7-methoxy-6-nitroquinazolin-4-amine |
| InChIKey | RJOOQLDHTIHUML-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)N=CN=C2NC3=CC(=C(C=C3)Cl)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)