CAS 179686-22-7 is the registry number for tert-Butyl 5-amino-3,6-dihydropyrazine-1(2H)-carboxylate hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl 6-amino-3,5-dihydro-2H-pyrazine-4-carboxylate;hydrochloride (CAS 179686-22-7) is a chemical compound with the molecular formula C9H18ClN3O2 and a molecular weight of 235.71 g/mol. IUPAC name: tert-butyl 6-amino-3,5-dihydro-2H-pyrazine-4-carboxylate;hydrochloride. InChIKey: MRXNSIJMEQUGON-UHFFFAOYSA-N.
| Molecular formula | C9H18ClN3O2 |
|---|---|
| Molecular weight | 235.71 g/mol |
| IUPAC name | tert-butyl 6-amino-3,5-dihydro-2H-pyrazine-4-carboxylate;hydrochloride |
| InChIKey | MRXNSIJMEQUGON-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN=C(C1)N.Cl |
Computed by PubChem (NCBI)