CAS 728944-69-2 appears in our catalog under these names: Vinyl–L–NIO (hydrochloride), Vinyl-L-NIO (hydrochloride), 95.0%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 100mg, 5mg, 50mg, 5 mg.
(2S)-2-amino-5-(1-aminobut-3-enylideneamino)pentanoic acid;hydrochloride (CAS 728944-69-2) is a chemical compound with the molecular formula C9H18ClN3O2 and a molecular weight of 235.71 g/mol. IUPAC name: (2S)-2-amino-5-(1-aminobut-3-enylideneamino)pentanoic acid;hydrochloride. InChIKey: DIWIMDZKSYTKCZ-FJXQXJEOSA-N.
| Molecular formula | C9H18ClN3O2 |
|---|---|
| Molecular weight | 235.71 g/mol |
| IUPAC name | (2S)-2-amino-5-(1-aminobut-3-enylideneamino)pentanoic acid;hydrochloride |
| InChIKey | DIWIMDZKSYTKCZ-FJXQXJEOSA-N |
| SMILES | C=CCC(=NCCC[C@@H](C(=O)O)N)N.Cl |
Computed by PubChem (NCBI)