Products 1796909-80-2

CAS 1796909-80-2 appears in our catalog under these names: 5,5-Dimethylmorpholine-3-carboxylic acid hydrochloride, 95%, 5,5-Dimethylmorpholine-3-carboxylic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

5,5-dimethylmorpholine-3-carboxylic acid;hydrochloride (CAS 1796909-80-2) is a chemical compound with the molecular formula C7H14ClNO3 and a molecular weight of 195.64 g/mol. IUPAC name: 5,5-dimethylmorpholine-3-carboxylic acid;hydrochloride. InChIKey: XEPCYVMPOUDEQV-UHFFFAOYSA-N.

Identity
Molecular formulaC7H14ClNO3
Molecular weight195.64 g/mol
IUPAC name5,5-dimethylmorpholine-3-carboxylic acid;hydrochloride
InChIKeyXEPCYVMPOUDEQV-UHFFFAOYSA-N
SMILESCC1(COCC(N1)C(=O)O)C.Cl

Computed by PubChem (NCBI)