Products 1797116-76-7
CAS 1797116-76-7 is the registry number for 6-Chloro-2-pyridinyl(2-quinolinyl)methanone. Offered by: TRC. Available pack sizes: 100mg.
(6-chloro-2-pyridinyl)-quinolin-2-ylmethanone (CAS 1797116-76-7) is a chemical compound with the molecular formula C15H9ClN2O and a molecular weight of 268.70 g/mol. IUPAC name: (6-chloro-2-pyridinyl)-quinolin-2-ylmethanone. InChIKey: SQFHGCTXSZMBPE-UHFFFAOYSA-N.
| Molecular formula | C15H9ClN2O |
|---|---|
| Molecular weight | 268.70 g/mol |
| IUPAC name | (6-chloro-2-pyridinyl)-quinolin-2-ylmethanone |
| InChIKey | SQFHGCTXSZMBPE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=N2)C(=O)C3=NC(=CC=C3)Cl |
Computed by PubChem (NCBI)