CAS 5958-05-4 appears in our catalog under these names: 6-Chloro-4-phenylquinazoline-2-carbaldehyde, 95%, 6-Chloro-4-phenylquinazoline-2-carbaldehyde 98%, Oxazepam EP Impurity C. Offered by: Combi-blocks, Ambeed, Chemat Brand. Available pack sizes: 250mg, 1g, 100mg, on request.
6-chloro-4-phenylquinazoline-2-carbaldehyde (CAS 5958-05-4) is a chemical compound with the molecular formula C15H9ClN2O and a molecular weight of 268.70 g/mol. IUPAC name: 6-chloro-4-phenylquinazoline-2-carbaldehyde. InChIKey: WZOTYGIIBJPOSP-UHFFFAOYSA-N.
| Molecular formula | C15H9ClN2O |
|---|---|
| Molecular weight | 268.70 g/mol |
| IUPAC name | 6-chloro-4-phenylquinazoline-2-carbaldehyde |
| InChIKey | WZOTYGIIBJPOSP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NC3=C2C=C(C=C3)Cl)C=O |
Computed by PubChem (NCBI)