Products 1797121-33-5
CAS 1797121-33-5 is the registry number for 4-(2-(Dipropylamino)ethyl)-3-diazooxindole. Offered by: TRC. Available pack sizes: 50mg, 5mg.
3-diazonio-4-[2-(dipropylamino)ethyl]-1H-indol-2-olate (CAS 1797121-33-5) is a chemical compound with the molecular formula C16H22N4O and a molecular weight of 286.37 g/mol. IUPAC name: 3-diazonio-4-[2-(dipropylamino)ethyl]-1H-indol-2-olate. InChIKey: CGNYNQQIIDJJFC-UHFFFAOYSA-N.
| Molecular formula | C16H22N4O |
|---|---|
| Molecular weight | 286.37 g/mol |
| IUPAC name | 3-diazonio-4-[2-(dipropylamino)ethyl]-1H-indol-2-olate |
| InChIKey | CGNYNQQIIDJJFC-UHFFFAOYSA-N |
| SMILES | CCCN(CCC)CCC1=C2C(=CC=C1)NC(=C2[N+]#N)[O-] |
Computed by PubChem (NCBI)