CAS 306937-06-4 is the registry number for 5-tert-Butyl-2-(3-methyl-benzyl)-2H-pyrazole-3-carboxylic acid hydrazide, 95%+. Offered by: Fluorochem. Available pack sizes: 250mg, 1g.
3-tert-butyl-1-[(3-methylphenyl)methyl]pyrazole-5-carbohydrazide (CAS 306937-06-4) is a chemical compound with the molecular formula C16H22N4O and a molecular weight of 286.37 g/mol. IUPAC name: 3-tert-butyl-1-[(3-methylphenyl)methyl]pyrazole-5-carbohydrazide. InChIKey: BURIRBNHVPFUOL-UHFFFAOYSA-N.
| Molecular formula | C16H22N4O |
|---|---|
| Molecular weight | 286.37 g/mol |
| IUPAC name | 3-tert-butyl-1-[(3-methylphenyl)methyl]pyrazole-5-carbohydrazide |
| InChIKey | BURIRBNHVPFUOL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)CN2C(=CC(=N2)C(C)(C)C)C(=O)NN |
Computed by PubChem (NCBI)