CAS 1797320-23-0 appears in our catalog under these names: 7-Amino-6,8-dibromo-1,2,3,4-tetrahydroquinolin-2-one, 95%, 7-Amino-6,8-dibromo-1,2,3,4-tetrahydroquinolin-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
7-amino-6,8-dibromo-3,4-dihydro-1H-quinolin-2-one (CAS 1797320-23-0) is a chemical compound with the molecular formula C9H8Br2N2O and a molecular weight of 319.98 g/mol. IUPAC name: 7-amino-6,8-dibromo-3,4-dihydro-1H-quinolin-2-one. InChIKey: CCVUHWUNSKNKQD-UHFFFAOYSA-N.
| Molecular formula | C9H8Br2N2O |
|---|---|
| Molecular weight | 319.98 g/mol |
| IUPAC name | 7-amino-6,8-dibromo-3,4-dihydro-1H-quinolin-2-one |
| InChIKey | CCVUHWUNSKNKQD-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC2=C(C(=C(C=C21)Br)N)Br |
Computed by PubChem (NCBI)