CAS 358780-20-8 is the registry number for 2-Bromo-1-{imidazo(1,2-a)pyridin-3-yl}ethan-1-one hydrobromide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-bromo-1-imidazo[1,2-a]pyridin-3-ylethanone;hydrobromide (CAS 358780-20-8) is a chemical compound with the molecular formula C9H8Br2N2O and a molecular weight of 319.98 g/mol. IUPAC name: 2-bromo-1-imidazo[1,2-a]pyridin-3-ylethanone;hydrobromide. InChIKey: VRGFTLWLEAVPPA-UHFFFAOYSA-N.
| Molecular formula | C9H8Br2N2O |
|---|---|
| Molecular weight | 319.98 g/mol |
| IUPAC name | 2-bromo-1-imidazo[1,2-a]pyridin-3-ylethanone;hydrobromide |
| InChIKey | VRGFTLWLEAVPPA-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=C(N2C=C1)C(=O)CBr.Br |
Computed by PubChem (NCBI)