Products 1797435-79-0
CAS 1797435-79-0 is the registry number for 3-Amino-2H-[1,2'-bipyridin]-2-one, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
3-amino-1-pyridin-2-ylpyridin-2-one (CAS 1797435-79-0) is a chemical compound with the molecular formula C10H9N3O and a molecular weight of 187.20 g/mol. IUPAC name: 3-amino-1-pyridin-2-ylpyridin-2-one. InChIKey: WNOJGCODYVEOMJ-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O |
|---|---|
| Molecular weight | 187.20 g/mol |
| IUPAC name | 3-amino-1-pyridin-2-ylpyridin-2-one |
| InChIKey | WNOJGCODYVEOMJ-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)N2C=CC=C(C2=O)N |
Computed by PubChem (NCBI)