Products 1797582-14-9
CAS 1797582-14-9 is the registry number for {1-(2-Chloro-5-(trifluoromethyl)phenyl)cyclopropyl}methanamine. Offered by: Biosynth. Available pack sizes: 100mg, 50mg, 250mg, 1000mg, 500mg.
[1-[2-chloro-5-(trifluoromethyl)phenyl]cyclopropyl]methanamine (CAS 1797582-14-9) is a chemical compound with the molecular formula C11H11ClF3N and a molecular weight of 249.66 g/mol. IUPAC name: [1-[2-chloro-5-(trifluoromethyl)phenyl]cyclopropyl]methanamine. InChIKey: FAAVCGJICKTEOD-UHFFFAOYSA-N.
| Molecular formula | C11H11ClF3N |
|---|---|
| Molecular weight | 249.66 g/mol |
| IUPAC name | [1-[2-chloro-5-(trifluoromethyl)phenyl]cyclopropyl]methanamine |
| InChIKey | FAAVCGJICKTEOD-UHFFFAOYSA-N |
| SMILES | C1CC1(CN)C2=C(C=CC(=C2)C(F)(F)F)Cl |
Computed by PubChem (NCBI)