CAS 1797646-62-8 is the registry number for 4-Chloro-N-methyl-N-(4-(4-(methylamino)phenyl)cyclohexyl)benzamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-chloro-N-methyl-N-[4-[4-(methylamino)phenyl]cyclohexyl]benzamide (CAS 1797646-62-8) is a chemical compound with the molecular formula C21H25ClN2O and a molecular weight of 356.9 g/mol. IUPAC name: 4-chloro-N-methyl-N-[4-[4-(methylamino)phenyl]cyclohexyl]benzamide. InChIKey: RYAUVHCJGWASCQ-UHFFFAOYSA-N.
| Molecular formula | C21H25ClN2O |
|---|---|
| Molecular weight | 356.9 g/mol |
| IUPAC name | 4-chloro-N-methyl-N-[4-[4-(methylamino)phenyl]cyclohexyl]benzamide |
| InChIKey | RYAUVHCJGWASCQ-UHFFFAOYSA-N |
| SMILES | CNC1=CC=C(C=C1)C2CCC(CC2)N(C)C(=O)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)