CAS 330216-78-9 is the registry number for 4-(tert-butyl)phenyl 4-(3-chlorophenyl)piperazinyl ketone. Offered by: Biosynth. Available pack sizes: 250mg.
(4-tert-butylphenyl)-[4-(3-chlorophenyl)piperazin-1-yl]methanone (CAS 330216-78-9) is a chemical compound with the molecular formula C21H25ClN2O and a molecular weight of 356.9 g/mol. IUPAC name: (4-tert-butylphenyl)-[4-(3-chlorophenyl)piperazin-1-yl]methanone. InChIKey: XMYJRTLQEAYIIE-UHFFFAOYSA-N.
| Molecular formula | C21H25ClN2O |
|---|---|
| Molecular weight | 356.9 g/mol |
| IUPAC name | (4-tert-butylphenyl)-[4-(3-chlorophenyl)piperazin-1-yl]methanone |
| InChIKey | XMYJRTLQEAYIIE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(=O)N2CCN(CC2)C3=CC(=CC=C3)Cl |
Computed by PubChem (NCBI)