CAS 1797717-71-5 appears in our catalog under these names: 5-(Piperazin-1-ylmethyl)thiophene-2-carboxylic acid dihydrochloride, 95%, 5-(Piperazin-1-ylmethyl)thiophene-2-carboxylic acid dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
5-(piperazin-1-ylmethyl)thiophene-2-carboxylic acid;dihydrochloride (CAS 1797717-71-5) is a chemical compound with the molecular formula C10H16Cl2N2O2S and a molecular weight of 299.22 g/mol. IUPAC name: 5-(piperazin-1-ylmethyl)thiophene-2-carboxylic acid;dihydrochloride. InChIKey: ATSZTAVJSNXSGE-UHFFFAOYSA-N.
| Molecular formula | C10H16Cl2N2O2S |
|---|---|
| Molecular weight | 299.22 g/mol |
| IUPAC name | 5-(piperazin-1-ylmethyl)thiophene-2-carboxylic acid;dihydrochloride |
| InChIKey | ATSZTAVJSNXSGE-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)CC2=CC=C(S2)C(=O)O.Cl.Cl |
Computed by PubChem (NCBI)