CAS 2248291-74-7 is the registry number for 4-Methyl-2-((pyrrolidin-3-yl)methyl)-1,3-thiazole-5-carboxylic acid dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-methyl-2-(pyrrolidin-3-ylmethyl)-1,3-thiazole-5-carboxylic acid;dihydrochloride (CAS 2248291-74-7) is a chemical compound with the molecular formula C10H16Cl2N2O2S and a molecular weight of 299.22 g/mol. IUPAC name: 4-methyl-2-(pyrrolidin-3-ylmethyl)-1,3-thiazole-5-carboxylic acid;dihydrochloride. InChIKey: QUUCTSURIFJTQV-UHFFFAOYSA-N.
| Molecular formula | C10H16Cl2N2O2S |
|---|---|
| Molecular weight | 299.22 g/mol |
| IUPAC name | 4-methyl-2-(pyrrolidin-3-ylmethyl)-1,3-thiazole-5-carboxylic acid;dihydrochloride |
| InChIKey | QUUCTSURIFJTQV-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)CC2CCNC2)C(=O)O.Cl.Cl |
Computed by PubChem (NCBI)