CAS 1797861-62-1 is the registry number for (3-Aminophenyl)-N-(4-(phenylamino)phenyl)formamide. Offered by: Biosynth. Available pack sizes: 1000mg, 500mg, 2000mg, 5000mg, 10000mg.
3-amino-N-(4-anilinophenyl)benzamide (CAS 1797861-62-1) is a chemical compound with the molecular formula C19H17N3O and a molecular weight of 303.4 g/mol. IUPAC name: 3-amino-N-(4-anilinophenyl)benzamide. InChIKey: DHYYHLSGCQREOR-UHFFFAOYSA-N.
| Molecular formula | C19H17N3O |
|---|---|
| Molecular weight | 303.4 g/mol |
| IUPAC name | 3-amino-N-(4-anilinophenyl)benzamide |
| InChIKey | DHYYHLSGCQREOR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC=C(C=C2)NC(=O)C3=CC(=CC=C3)N |
Computed by PubChem (NCBI)