Products 946005-73-8
CAS 946005-73-8 is the registry number for 4-[Bis(pyridin-2-ylmethyl)amino]benzaldehyde, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-[bis(pyridin-2-ylmethyl)amino]benzaldehyde (CAS 946005-73-8) is a chemical compound with the molecular formula C19H17N3O and a molecular weight of 303.4 g/mol. IUPAC name: 4-[bis(pyridin-2-ylmethyl)amino]benzaldehyde. InChIKey: WQKMIHWMIUFZSW-UHFFFAOYSA-N.
| Molecular formula | C19H17N3O |
|---|---|
| Molecular weight | 303.4 g/mol |
| IUPAC name | 4-[bis(pyridin-2-ylmethyl)amino]benzaldehyde |
| InChIKey | WQKMIHWMIUFZSW-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)CN(CC2=CC=CC=N2)C3=CC=C(C=C3)C=O |
Computed by PubChem (NCBI)