CAS 1797911-12-6 appears in our catalog under these names: Dimenhydrinate Impurity 5, 8-(6-Methyl-furo(3,40c)pyridin-7-yloxy)theophylline. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1g.
1,3-dimethyl-8-[(6-methyl-1,3-dihydrofuro[3,4-c]pyridin-7-yl)oxy]-7H-purine-2,6-dione (CAS 1797911-12-6) is a chemical compound with the molecular formula C15H15N5O4 and a molecular weight of 329.31 g/mol. IUPAC name: 1,3-dimethyl-8-[(6-methyl-1,3-dihydrofuro[3,4-c]pyridin-7-yl)oxy]-7H-purine-2,6-dione. InChIKey: IYHKBGZFGONMBV-UHFFFAOYSA-N.
| Molecular formula | C15H15N5O4 |
|---|---|
| Molecular weight | 329.31 g/mol |
| IUPAC name | 1,3-dimethyl-8-[(6-methyl-1,3-dihydrofuro[3,4-c]pyridin-7-yl)oxy]-7H-purine-2,6-dione |
| InChIKey | IYHKBGZFGONMBV-UHFFFAOYSA-N |
| SMILES | CC1=NC=C2COCC2=C1OC3=NC4=C(N3)C(=O)N(C(=O)N4C)C |
Computed by PubChem (NCBI)