CAS 7000-61-5 is the registry number for 4-{((1,3-dimethyl-2,6-dioxo-2,3,6,7-tetrahydro-1h-purin-8-yl)methyl)aminobenzoic acid, 95%. Offered by: AmBeed. Available pack sizes: 250mg, 100mg.
4-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)methylamino]benzoic acid (CAS 7000-61-5) is a chemical compound with the molecular formula C15H15N5O4 and a molecular weight of 329.31 g/mol. IUPAC name: 4-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)methylamino]benzoic acid. InChIKey: ADUXQWIKSOSSDH-UHFFFAOYSA-N.
| Molecular formula | C15H15N5O4 |
|---|---|
| Molecular weight | 329.31 g/mol |
| IUPAC name | 4-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)methylamino]benzoic acid |
| InChIKey | ADUXQWIKSOSSDH-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)N(C1=O)C)NC(=N2)CNC3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)