Products 1798293-02-3

CAS 1798293-02-3 is the registry number for 2-((2-Amino-3-chlorophenyl)thio)-benzoic Acid Methyl Ester. Offered by: TRC. Available pack sizes: 100mg, 250mg, 50mg.

Structural formula: {0} (CAS {1})

Methyl 2-(2-amino-3-chlorophenyl)sulfanylbenzoate (CAS 1798293-02-3) is a chemical compound with the molecular formula C14H12ClNO2S and a molecular weight of 293.8 g/mol. IUPAC name: methyl 2-(2-amino-3-chlorophenyl)sulfanylbenzoate. InChIKey: MLXRXVTWDLLQMH-UHFFFAOYSA-N.

Identity
Molecular formulaC14H12ClNO2S
Molecular weight293.8 g/mol
IUPAC namemethyl 2-(2-amino-3-chlorophenyl)sulfanylbenzoate
InChIKeyMLXRXVTWDLLQMH-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC=CC=C1SC2=C(C(=CC=C2)Cl)N

Computed by PubChem (NCBI)