CAS 62835-54-5 is the registry number for 2-Chloro-7-(methoxymethoxy)-10H-phenothiazine. Offered by: TRC. Available pack sizes: 2,5g.
2-chloro-7-(methoxymethoxy)-10H-phenothiazine (CAS 62835-54-5) is a chemical compound with the molecular formula C14H12ClNO2S and a molecular weight of 293.8 g/mol. IUPAC name: 2-chloro-7-(methoxymethoxy)-10H-phenothiazine. InChIKey: CBLOTTRGIFDJHI-UHFFFAOYSA-N.
| Molecular formula | C14H12ClNO2S |
|---|---|
| Molecular weight | 293.8 g/mol |
| IUPAC name | 2-chloro-7-(methoxymethoxy)-10H-phenothiazine |
| InChIKey | CBLOTTRGIFDJHI-UHFFFAOYSA-N |
| SMILES | COCOC1=CC2=C(C=C1)NC3=C(S2)C=CC(=C3)Cl |
Computed by PubChem (NCBI)