CAS 1798310-47-0 appears in our catalog under these names: 3-(Oxan-4-yl)pentanedioic Acid, >95% (HPLC), 3-(tetrahydro-2H-pyran-4-yl)pentanedioic acid, 98%, Tepraloxydim-glutaric acid, Tepraloxydim-glutaric acid 100 µg/mL in Acetonitrile, 3–(Tetrahydro–2H–pyran–4–yl)pentanedioic acid. Offered by: TRC, AmBeed, Dr. Ehrenstorfer, GLPBio, Biosynth. Available pack sizes: 100mg, 10mg, 25mg, 5g, 1g, 1ml, 250mg, 50mg.
3-(oxan-4-yl)pentanedioic acid (CAS 1798310-47-0) is a chemical compound with the molecular formula C10H16O5 and a molecular weight of 216.23 g/mol. IUPAC name: 3-(oxan-4-yl)pentanedioic acid. InChIKey: GAEHHQXUAGOYTA-UHFFFAOYSA-N.
| Molecular formula | C10H16O5 |
|---|---|
| Molecular weight | 216.23 g/mol |
| IUPAC name | 3-(oxan-4-yl)pentanedioic acid |
| InChIKey | GAEHHQXUAGOYTA-UHFFFAOYSA-N |
| SMILES | C1COCCC1C(CC(=O)O)CC(=O)O |
Computed by PubChem (NCBI)