Products 1798419-06-3
CAS 1798419-06-3 is the registry number for (3,5-Dimethyl-2-hexeno)-4-isopropenylphenone. Offered by: TRC. Available pack sizes: 500mg.
3,5-dimethyl-1-(4-prop-1-en-2-ylphenyl)hex-2-en-1-one (CAS 1798419-06-3) is a chemical compound with the molecular formula C17H22O and a molecular weight of 242.36 g/mol. IUPAC name: 3,5-dimethyl-1-(4-prop-1-en-2-ylphenyl)hex-2-en-1-one. InChIKey: HHAXSPROQUCRBK-UHFFFAOYSA-N.
| Molecular formula | C17H22O |
|---|---|
| Molecular weight | 242.36 g/mol |
| IUPAC name | 3,5-dimethyl-1-(4-prop-1-en-2-ylphenyl)hex-2-en-1-one |
| InChIKey | HHAXSPROQUCRBK-UHFFFAOYSA-N |
| SMILES | CC(C)CC(=CC(=O)C1=CC=C(C=C1)C(=C)C)C |
Computed by PubChem (NCBI)