Products 726-94-3
CAS 726-94-3 is the registry number for Adapalene Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-methoxyphenyl)adamantane (CAS 726-94-3) is a chemical compound with the molecular formula C17H22O and a molecular weight of 242.36 g/mol. IUPAC name: 1-(4-methoxyphenyl)adamantane. InChIKey: JVLXCCLBXVMRDG-UHFFFAOYSA-N.
| Molecular formula | C17H22O |
|---|---|
| Molecular weight | 242.36 g/mol |
| IUPAC name | 1-(4-methoxyphenyl)adamantane |
| InChIKey | JVLXCCLBXVMRDG-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C23CC4CC(C2)CC(C4)C3 |
Computed by PubChem (NCBI)