CAS 1798718-32-7 appears in our catalog under these names: Methyl 2-(trifluoromethyl)-4,5-dihydro-1,3-oxazole-5-carboxylate, 95%, Methyl 2-(trifluoromethyl)-4,5-dihydro-1,3-oxazole-5-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Methyl 2-(trifluoromethyl)-4,5-dihydro-1,3-oxazole-5-carboxylate (CAS 1798718-32-7) is a chemical compound with the molecular formula C6H6F3NO3 and a molecular weight of 197.11 g/mol. IUPAC name: methyl 2-(trifluoromethyl)-4,5-dihydro-1,3-oxazole-5-carboxylate. InChIKey: JMCKKBXRDJWBQY-UHFFFAOYSA-N.
| Molecular formula | C6H6F3NO3 |
|---|---|
| Molecular weight | 197.11 g/mol |
| IUPAC name | methyl 2-(trifluoromethyl)-4,5-dihydro-1,3-oxazole-5-carboxylate |
| InChIKey | JMCKKBXRDJWBQY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CN=C(O1)C(F)(F)F |
Computed by PubChem (NCBI)