CAS 669066-98-2 appears in our catalog under these names: 1-(2,2,2-Trifluoroacetamido)cyclopropanecarboxylic acid, 95%, 1-(2,2,2-Trifluoroacetamido)-cyclopropanecarboxylic acid, 97%, 1-(2,2,2-TRIFLUOROACETAMIDO)CYCLOPROPANECARBOXYLIC ACID, 97%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.
1-[(2,2,2-trifluoroacetyl)amino]cyclopropane-1-carboxylic acid (CAS 669066-98-2) is a chemical compound with the molecular formula C6H6F3NO3 and a molecular weight of 197.11 g/mol. IUPAC name: 1-[(2,2,2-trifluoroacetyl)amino]cyclopropane-1-carboxylic acid. InChIKey: ZWFYYKVOJQHLTH-UHFFFAOYSA-N.
| Molecular formula | C6H6F3NO3 |
|---|---|
| Molecular weight | 197.11 g/mol |
| IUPAC name | 1-[(2,2,2-trifluoroacetyl)amino]cyclopropane-1-carboxylic acid |
| InChIKey | ZWFYYKVOJQHLTH-UHFFFAOYSA-N |
| SMILES | C1CC1(C(=O)O)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)