Products 1799296-01-7
CAS 1799296-01-7 is the registry number for 4-(4'-chloro-[1,1'-biphenyl]-4-yl)-2,6-diphenylpyrimidine, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
4-[4-(4-chlorophenyl)phenyl]-2,6-diphenylpyrimidine (CAS 1799296-01-7) is a chemical compound with the molecular formula C28H19ClN2 and a molecular weight of 418.9 g/mol. IUPAC name: 4-[4-(4-chlorophenyl)phenyl]-2,6-diphenylpyrimidine. InChIKey: LPACEOPMMJUFNW-UHFFFAOYSA-N.
| Molecular formula | C28H19ClN2 |
|---|---|
| Molecular weight | 418.9 g/mol |
| IUPAC name | 4-[4-(4-chlorophenyl)phenyl]-2,6-diphenylpyrimidine |
| InChIKey | LPACEOPMMJUFNW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NC(=N2)C3=CC=CC=C3)C4=CC=C(C=C4)C5=CC=C(C=C5)Cl |
Computed by PubChem (NCBI)