CAS 2525337-21-5 is the registry number for 4,6-Bis([1,1′-biphenyl]-2-yl)-2-chloropyrimidine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
2-chloro-4,6-bis(2-phenylphenyl)pyrimidine (CAS 2525337-21-5) is a chemical compound with the molecular formula C28H19ClN2 and a molecular weight of 418.9 g/mol. IUPAC name: 2-chloro-4,6-bis(2-phenylphenyl)pyrimidine. InChIKey: GFQPROZZLRCIMA-UHFFFAOYSA-N.
| Molecular formula | C28H19ClN2 |
|---|---|
| Molecular weight | 418.9 g/mol |
| IUPAC name | 2-chloro-4,6-bis(2-phenylphenyl)pyrimidine |
| InChIKey | GFQPROZZLRCIMA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=C2C3=CC(=NC(=N3)Cl)C4=CC=CC=C4C5=CC=CC=C5 |
Computed by PubChem (NCBI)