CAS 1800022-01-8 is the registry number for N-(2-Chlorophenyl)-7-phenyl-7H-benzo[a]carbazol-9-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
N-(2-chlorophenyl)-7-phenyl-7H-benzo[a]carbazol-9-amine (CAS 1800022-01-8) is a chemical compound with the molecular formula C28H19ClN2 and a molecular weight of 418.9 g/mol. IUPAC name: N-(2-chlorophenyl)-7-phenyl-7H-benzo[a]carbazol-9-amine. InChIKey: UZGILIFQIQIZLM-UHFFFAOYSA-N.
| Molecular formula | C28H19ClN2 |
|---|---|
| Molecular weight | 418.9 g/mol |
| IUPAC name | N-(2-chlorophenyl)-7-phenyl-7H-benzo[a]carbazol-9-amine |
| InChIKey | UZGILIFQIQIZLM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2C=C(C=C3C2=C4C=CC5=CC=CC=C5C4=N3)NC6=CC=CC=C6Cl |
Computed by PubChem (NCBI)