CAS 1799412-23-9 appears in our catalog under these names: (R)-2-((5-Chloro-4-iodopyridin-2-yl)amino)propan-1-ol, 95%, (R)–2–((5–Chloro–4–iodopyridin–2–yl)amino)propan–1–ol. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 5g.
(2R)-2-[(5-chloro-4-iodo-2-pyridinyl)amino]propan-1-ol (CAS 1799412-23-9) is a chemical compound with the molecular formula C8H10ClIN2O and a molecular weight of 312.53 g/mol. IUPAC name: (2R)-2-[(5-chloro-4-iodo-2-pyridinyl)amino]propan-1-ol. InChIKey: CEDNQGKJSNBQPS-RXMQYKEDSA-N.
| Molecular formula | C8H10ClIN2O |
|---|---|
| Molecular weight | 312.53 g/mol |
| IUPAC name | (2R)-2-[(5-chloro-4-iodo-2-pyridinyl)amino]propan-1-ol |
| InChIKey | CEDNQGKJSNBQPS-RXMQYKEDSA-N |
| SMILES | C[C@H](CO)NC1=NC=C(C(=C1)I)Cl |
Computed by PubChem (NCBI)