CAS 855482-29-0 appears in our catalog under these names: 2-Amino-N-(4-iodophenyl)acetamide hydrochloride, 95%, 2-Amino-N-(4-iodophenyl)acetamide hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
2-amino-N-(4-iodophenyl)acetamide;hydrochloride (CAS 855482-29-0) is a chemical compound with the molecular formula C8H10ClIN2O and a molecular weight of 312.53 g/mol. IUPAC name: 2-amino-N-(4-iodophenyl)acetamide;hydrochloride. InChIKey: SUYHKARYJIVKRP-UHFFFAOYSA-N.
| Molecular formula | C8H10ClIN2O |
|---|---|
| Molecular weight | 312.53 g/mol |
| IUPAC name | 2-amino-N-(4-iodophenyl)acetamide;hydrochloride |
| InChIKey | SUYHKARYJIVKRP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)CN)I.Cl |
Computed by PubChem (NCBI)