Products 1799412-34-2

CAS 1799412-34-2 is the registry number for (R)-3-(1-Carboxypropoxy)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

3-[(1R)-1-carboxypropoxy]benzoic acid (CAS 1799412-34-2) is a chemical compound with the molecular formula C11H12O5 and a molecular weight of 224.21 g/mol. IUPAC name: 3-[(1R)-1-carboxypropoxy]benzoic acid. InChIKey: CKIVNPJBBIDRHO-SECBINFHSA-N.

Identity
Molecular formulaC11H12O5
Molecular weight224.21 g/mol
IUPAC name3-[(1R)-1-carboxypropoxy]benzoic acid
InChIKeyCKIVNPJBBIDRHO-SECBINFHSA-N
SMILESCC[C@H](C(=O)O)OC1=CC=CC(=C1)C(=O)O

Computed by PubChem (NCBI)