CAS 3645-00-9 appears in our catalog under these names: Terephthalic acid 2-hydroxyethyl methyl ester, 95%, 2-Hydroxyethyl Methyl Terephthalate, 2–Hydroxyethyl Methyl Terephthalate, 1-(2-Hydroxyethyl) 4-methyl terephthalate, 2-Hydroxyethyl Methyl Terephthalate, >97.0%(GC). Offered by: Combi-blocks, TRC, GLPBio, Biosynth, TCI. Available pack sizes: 1g, 10g, 5g, 2,5g, 250mg, 500mg, 25g, 100mg.
4-O-(2-hydroxyethyl) 1-O-methyl benzene-1,4-dicarboxylate (CAS 3645-00-9) is a chemical compound with the molecular formula C11H12O5 and a molecular weight of 224.21 g/mol. IUPAC name: 4-O-(2-hydroxyethyl) 1-O-methyl benzene-1,4-dicarboxylate. InChIKey: DJQMYWWZWUOCBQ-UHFFFAOYSA-N.
| Molecular formula | C11H12O5 |
|---|---|
| Molecular weight | 224.21 g/mol |
| IUPAC name | 4-O-(2-hydroxyethyl) 1-O-methyl benzene-1,4-dicarboxylate |
| InChIKey | DJQMYWWZWUOCBQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C(=O)OCCO |
Computed by PubChem (NCBI)