Products 38421-98-6
CAS 38421-98-6 appears in our catalog under these names: 3,4-Dimethoxy-5-hydroxycinnamic acid, 98%, 3,4-Dimethoxy-5-hydroxycinnamic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 5g, 1g, 0,5g, 2g.
(E)-3-(3-hydroxy-4,5-dimethoxyphenyl)prop-2-enoic acid (CAS 38421-98-6) is a chemical compound with the molecular formula C11H12O5 and a molecular weight of 224.21 g/mol. IUPAC name: (E)-3-(3-hydroxy-4,5-dimethoxyphenyl)prop-2-enoic acid. InChIKey: NDGIDRFOPAADDX-ONEGZZNKSA-N.
| Molecular formula | C11H12O5 |
|---|---|
| Molecular weight | 224.21 g/mol |
| IUPAC name | (E)-3-(3-hydroxy-4,5-dimethoxyphenyl)prop-2-enoic acid |
| InChIKey | NDGIDRFOPAADDX-ONEGZZNKSA-N |
| SMILES | COC1=CC(=CC(=C1OC)O)/C=C/C(=O)O |
Computed by PubChem (NCBI)