CAS 1799438-97-3 is the registry number for (R)–tert–Butyl (1–(2–bromo–4–chlorophenyl)ethyl)carbamate. Offered by: GLPBio. Available pack sizes: 1g, 250mg.
Tert-butyl N-[(1R)-1-(2-bromo-4-chlorophenyl)ethyl]carbamate (CAS 1799438-97-3) is a chemical compound with the molecular formula C13H17BrClNO2 and a molecular weight of 334.63 g/mol. IUPAC name: tert-butyl N-[(1R)-1-(2-bromo-4-chlorophenyl)ethyl]carbamate. InChIKey: KQNRMISRZVQOTB-MRVPVSSYSA-N.
| Molecular formula | C13H17BrClNO2 |
|---|---|
| Molecular weight | 334.63 g/mol |
| IUPAC name | tert-butyl N-[(1R)-1-(2-bromo-4-chlorophenyl)ethyl]carbamate |
| InChIKey | KQNRMISRZVQOTB-MRVPVSSYSA-N |
| SMILES | C[C@H](C1=C(C=C(C=C1)Cl)Br)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)